TY - JOUR
T1 - Trisimidazole complexes of ruthenium and osmium
AU - Elgafi, Sarah
AU - Field, Leslie D.
AU - Messerle, Barbara A.
AU - Buys, Irmi E.
AU - Hambley, Trevor W.
PY - 1997/6/20
Y1 - 1997/6/20
N2 - The preparation and characterisation of ruthenium(II) and osmium(II) complexes with the trisimidazole ligands tris(N-methylimidazol-2-yl)methanol (1a) ((mim)3COH) and tris(N-ethoxymethylimidazol-2-yl)methanol (1b) ((emim)3COH) are reported (mim = N-methylimidazol-2-yl, emim = N-ethoxymethylimidazol-2-yl). The complex [{RuCl(PPh3)2((mim)3COH)}+Cl-] (2) was formed by the reaction of (mim)3COH with [RuCl2(PPh3)4]. The complexes [{Ru(PPh3)(CO)H((mim)3COH)}+Cl-] (3a) and [{Ru(PPh3)(CO)H((emim)3COH)}+Cl-] (3b) were formed by the reaction of (mim)3COH or (emim)3COH (respectively) with [Ru(PPh3)3HCl(CO)]. Likewise, the reaction of (mim)3COH or (emim)3COH (respectively) with [Os(PPh3)3HCl(CO)] formed [{Os(PPh3)(CO)H((mim)3COH)}+Cl-] (4a) and [{Os(PPh3)(CO)H((emim)3COH)}+Cl-] (4b). The ruthenium monohydride complex [{Ru(PPh3)(CO)H((mim)3COH)}+Cl-] (3a) adds to the terminal C-H bond of phenylacetylene to form the vinyl complex [{Ru(PPh3)(CO)(CH=CHPh)((mim)3COH)}+Cl-] (5). The air-stable complexes were characterised by multinuclear NMR spectroscopy and 2 and 3b were characterised by X-ray crystallography. Crystals of 2, C49H46N6OP2RuCl2, M 968.87, are triclinic, space group P1̄, a = 12.011(5), b = 13.342(3), c = 16.554(6) Å, α = 89.26(3)°, β = 76.94(3)°, γ = 77.43(3)°, Ζ = 2. Crystals of 3b, C38H44N6O5PRuCl, Μ 832.30, are triclinic, space group P1̄, a = 12.759(3), b= 13.017(2), c= 13.167(4) Å, α = 87.65(2)°, β = 64.09(2)°, γ = 88.82(2)°, Ζ =2.
AB - The preparation and characterisation of ruthenium(II) and osmium(II) complexes with the trisimidazole ligands tris(N-methylimidazol-2-yl)methanol (1a) ((mim)3COH) and tris(N-ethoxymethylimidazol-2-yl)methanol (1b) ((emim)3COH) are reported (mim = N-methylimidazol-2-yl, emim = N-ethoxymethylimidazol-2-yl). The complex [{RuCl(PPh3)2((mim)3COH)}+Cl-] (2) was formed by the reaction of (mim)3COH with [RuCl2(PPh3)4]. The complexes [{Ru(PPh3)(CO)H((mim)3COH)}+Cl-] (3a) and [{Ru(PPh3)(CO)H((emim)3COH)}+Cl-] (3b) were formed by the reaction of (mim)3COH or (emim)3COH (respectively) with [Ru(PPh3)3HCl(CO)]. Likewise, the reaction of (mim)3COH or (emim)3COH (respectively) with [Os(PPh3)3HCl(CO)] formed [{Os(PPh3)(CO)H((mim)3COH)}+Cl-] (4a) and [{Os(PPh3)(CO)H((emim)3COH)}+Cl-] (4b). The ruthenium monohydride complex [{Ru(PPh3)(CO)H((mim)3COH)}+Cl-] (3a) adds to the terminal C-H bond of phenylacetylene to form the vinyl complex [{Ru(PPh3)(CO)(CH=CHPh)((mim)3COH)}+Cl-] (5). The air-stable complexes were characterised by multinuclear NMR spectroscopy and 2 and 3b were characterised by X-ray crystallography. Crystals of 2, C49H46N6OP2RuCl2, M 968.87, are triclinic, space group P1̄, a = 12.011(5), b = 13.342(3), c = 16.554(6) Å, α = 89.26(3)°, β = 76.94(3)°, γ = 77.43(3)°, Ζ = 2. Crystals of 3b, C38H44N6O5PRuCl, Μ 832.30, are triclinic, space group P1̄, a = 12.759(3), b= 13.017(2), c= 13.167(4) Å, α = 87.65(2)°, β = 64.09(2)°, γ = 88.82(2)°, Ζ =2.
UR - http://www.scopus.com/inward/record.url?scp=0031580149&partnerID=8YFLogxK
M3 - Article
AN - SCOPUS:0031580149
SN - 0022-328X
VL - 538
SP - 119
EP - 128
JO - Journal of Organometallic Chemistry
JF - Journal of Organometallic Chemistry
IS - 1-2
ER -